C7H11ClN4O — CID 104862063
2-(5-chloro-1,3-dimethylpyrazol-4-yl)-N'-hydroxyethanimidamide (PubChem CID 104862063) has the molecular formula C7H11ClN4O and a molecular weight of 202.65 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 104862063 |
| Molecular Formula | C7H11ClN4O |
| Molecular Weight | 202.65 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 2-(5-chloro-1,3-dimethylpyrazol-4-yl)-N'-hydroxyethanimidamide |
| SMILES | Cc1nn(C)c(Cl)c1CC(N)=NO |
| InChI | InChI=1S/C7H11ClN4O/c1-4-5(3-6(9)11-13)7(8)12(2)10-4/h13H,3H2,1-2H3,(H2,9,11) |
| InChIKey | ABVUECXOTOEJHY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.65 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|