C10H23N3OS — CID 104863498
3-[3-ethylsulfanylpropyl(methyl)amino]-N'-hydroxybutanimidamide (PubChem CID 104863498) has the molecular formula C10H23N3OS and a molecular weight of 233.38 g/mol. Its IUPAC name is 3-[3-ethylsulfanylpropyl(methyl)amino]-N'-hydroxybutanimidamide.
| Compound Name | 3-[3-ethylsulfanylpropyl(methyl)amino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 104863498 |
| Molecular Formula | C10H23N3OS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 3-[3-ethylsulfanylpropyl(methyl)amino]-N'-hydroxybutanimidamide |
| SMILES | CCSCCCN(C)C(C)CC(N)=NO |
| InChI | InChI=1S/C10H23N3OS/c1-4-15-7-5-6-13(3)9(2)8-10(11)12-14/h9,14H,4-8H2,1-3H3,(H2,11,12) |
| InChIKey | OUOBCDOYQJBPCJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|