C10H22N2 — CID 104864569
3-N-but-3-en-2-yl-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 104864569) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 3-N-but-3-en-2-yl-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-but-3-en-2-yl-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 104864569 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 3-N-but-3-en-2-yl-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | C=CC(C)NC(C)CCN(C)C |
| InChI | InChI=1S/C10H22N2/c1-6-9(2)11-10(3)7-8-12(4)5/h6,9-11H,1,7-8H2,2-5H3 |
| InChIKey | MBRJNPWUYZBZQJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|