C8H19N3O2S — CID 104865883
N'-hydroxy-4-(1-methylsulfinylpropan-2-ylamino)butanimidamide (PubChem CID 104865883) has the molecular formula C8H19N3O2S and a molecular weight of 221.33 g/mol. Its IUPAC name is N'-hydroxy-4-(1-methylsulfinylpropan-2-ylamino)butanimidamide.
| Compound Name | N'-hydroxy-4-(1-methylsulfinylpropan-2-ylamino)butanimidamide |
|---|---|
| PubChem CID | 104865883 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N'-hydroxy-4-(1-methylsulfinylpropan-2-ylamino)butanimidamide |
| SMILES | CC(CS(C)=O)NCCCC(N)=NO |
| InChI | InChI=1S/C8H19N3O2S/c1-7(6-14(2)13)10-5-3-4-8(9)11-12/h7,10,12H,3-6H2,1-2H3,(H2,9,11) |
| InChIKey | HUTPNNKPGPVRAF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|