C10H23N3O — CID 77029951
N'-hydroxy-3-(5-methylhexan-2-ylamino)propanimidamide (PubChem CID 77029951) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is N'-hydroxy-3-(5-methylhexan-2-ylamino)propanimidamide.
| Compound Name | N'-hydroxy-3-(5-methylhexan-2-ylamino)propanimidamide |
|---|---|
| PubChem CID | 77029951 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | N'-hydroxy-3-(5-methylhexan-2-ylamino)propanimidamide |
| SMILES | CC(C)CCC(C)NCCC(N)=NO |
| InChI | InChI=1S/C10H23N3O/c1-8(2)4-5-9(3)12-7-6-10(11)13-14/h8-9,12,14H,4-7H2,1-3H3,(H2,11,13) |
| InChIKey | GNFIHBZZYCGDDD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|