C9H19N3O — CID 104876523
2-(3-cyclopropylpropylamino)-N'-hydroxypropanimidamide (PubChem CID 104876523) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-(3-cyclopropylpropylamino)-N'-hydroxypropanimidamide.
| Compound Name | 2-(3-cyclopropylpropylamino)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 104876523 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 2-(3-cyclopropylpropylamino)-N'-hydroxypropanimidamide |
| SMILES | CC(NCCCC1CC1)C(N)=NO |
| InChI | InChI=1S/C9H19N3O/c1-7(9(10)12-13)11-6-2-3-8-4-5-8/h7-8,11,13H,2-6H2,1H3,(H2,10,12) |
| InChIKey | XATPVRDRWDIUGI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|