C15H18ClN3OS — CID 104878920
3-[(5-chloro-1,3-thiazol-2-yl)methylamino]-N,N-diethylbenzamide (PubChem CID 104878920) has the molecular formula C15H18ClN3OS and a molecular weight of 323.85 g/mol. Its IUPAC name is 3-[(5-chloro-1,3-thiazol-2-yl)methylamino]-N,N-diethylbenzamide.
| Compound Name | 3-[(5-chloro-1,3-thiazol-2-yl)methylamino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 104878920 |
| Molecular Formula | C15H18ClN3OS |
| Molecular Weight | 323.85 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-[(5-chloro-1,3-thiazol-2-yl)methylamino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NCc2ncc(Cl)s2)c1 |
| InChI | InChI=1S/C15H18ClN3OS/c1-3-19(4-2)15(20)11-6-5-7-12(8-11)17-10-14-18-9-13(16)21-14/h5-9,17H,3-4,10H2,1-2H3 |
| InChIKey | OYICODIISKMTAW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.85 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |