C8H19N5O — CID 104882331
1-amino-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine (PubChem CID 104882331) has the molecular formula C8H19N5O and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-amino-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine.
| Compound Name | 1-amino-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 104882331 |
| Molecular Formula | C8H19N5O |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 1-amino-2-methyl-3-[(4-methylmorpholin-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NN)NCC1CN(C)CCO1 |
| InChI | InChI=1S/C8H19N5O/c1-10-8(12-9)11-5-7-6-13(2)3-4-14-7/h7H,3-6,9H2,1-2H3,(H2,10,11,12) |
| InChIKey | LMIUBXTWIZDJLC-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 74.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|