C10H20N4 — CID 104882395
N-amino-N'-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboximidamide (PubChem CID 104882395) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is N-amino-N'-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboximidamide.
| Compound Name | N-amino-N'-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 104882395 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N-amino-N'-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboximidamide |
| SMILES | C/N=C(\NN)N1CCC2CCCCC21 |
| InChI | InChI=1S/C10H20N4/c1-12-10(13-11)14-7-6-8-4-2-3-5-9(8)14/h8-9H,2-7,11H2,1H3,(H,12,13) |
| InChIKey | OITBHXRZNBEQDH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|