C8H14N4O — CID 163576501
(2S)-N-amino-2-(2-hydroxyethynyl)-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 163576501) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is (2S)-N-amino-2-(2-hydroxyethynyl)-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | (2S)-N-amino-2-(2-hydroxyethynyl)-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 163576501 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (2S)-N-amino-2-(2-hydroxyethynyl)-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NN)N1CCC[C@H]1C#CO |
| InChI | InChI=1S/C8H14N4O/c1-10-8(11-9)12-5-2-3-7(12)4-6-13/h7,13H,2-3,5,9H2,1H3,(H,10,11)/t7-/m0/s1 |
| InChIKey | GDXSSUDNQMXNNS-ZETCQYMHSA-N |
| XLogP | -0.77 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|