C9H18N4 — CID 130815998
N-amino-N'-methyl-8-azabicyclo[3.2.1]octane-8-carboximidamide (PubChem CID 130815998) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is N-amino-N'-methyl-8-azabicyclo[3.2.1]octane-8-carboximidamide.
| Compound Name | N-amino-N'-methyl-8-azabicyclo[3.2.1]octane-8-carboximidamide |
|---|---|
| PubChem CID | 130815998 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | N-amino-N'-methyl-8-azabicyclo[3.2.1]octane-8-carboximidamide |
| SMILES | C/N=C(\NN)N1C2CCCC1CC2 |
| InChI | InChI=1S/C9H18N4/c1-11-9(12-10)13-7-3-2-4-8(13)6-5-7/h7-8H,2-6,10H2,1H3,(H,11,12) |
| InChIKey | LOQZUJKBQCAGIY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|