C10H22N4O2 — CID 104883311
N-amino-N'-(1-methoxypropan-2-yl)-2-methylmorpholine-4-carboximidamide (PubChem CID 104883311) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-amino-N'-(1-methoxypropan-2-yl)-2-methylmorpholine-4-carboximidamide.
| Compound Name | N-amino-N'-(1-methoxypropan-2-yl)-2-methylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 104883311 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | N-amino-N'-(1-methoxypropan-2-yl)-2-methylmorpholine-4-carboximidamide |
| SMILES | COCC(C)/N=C(\NN)N1CCOC(C)C1 |
| InChI | InChI=1S/C10H22N4O2/c1-8(7-15-3)12-10(13-11)14-4-5-16-9(2)6-14/h8-9H,4-7,11H2,1-3H3,(H,12,13) |
| InChIKey | USNNZNLXTHVTPH-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|