C13H27N5O — CID 104887394
N-amino-N'-(1-methoxypropan-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboximidamide (PubChem CID 104887394) has the molecular formula C13H27N5O and a molecular weight of 269.39 g/mol. Its IUPAC name is N-amino-N'-(1-methoxypropan-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboximidamide.
| Compound Name | N-amino-N'-(1-methoxypropan-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 104887394 |
| Molecular Formula | C13H27N5O |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | N-amino-N'-(1-methoxypropan-2-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboximidamide |
| SMILES | COCC(C)/N=C(\NN)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C13H27N5O/c1-11(10-19-2)15-13(16-14)18-8-7-17-6-4-3-5-12(17)9-18/h11-12H,3-10,14H2,1-2H3,(H,15,16) |
| InChIKey | GXPQJWIBYSUNQS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|