C12H25N5O — CID 104887359
N-amino-N'-(1-methoxypropan-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboximidamide (PubChem CID 104887359) has the molecular formula C12H25N5O and a molecular weight of 255.37 g/mol. Its IUPAC name is N-amino-N'-(1-methoxypropan-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboximidamide.
| Compound Name | N-amino-N'-(1-methoxypropan-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 104887359 |
| Molecular Formula | C12H25N5O |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | N-amino-N'-(1-methoxypropan-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboximidamide |
| SMILES | COCC(C)/N=C(\NN)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C12H25N5O/c1-10(9-18-2)14-12(15-13)17-7-6-16-5-3-4-11(16)8-17/h10-11H,3-9,13H2,1-2H3,(H,14,15) |
| InChIKey | JHZRPLZDWYCVGA-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|