C12H26N4O — CID 104884194
N-amino-N'-(1-methoxypropan-2-yl)-2,3-dimethylpiperidine-1-carboximidamide (PubChem CID 104884194) has the molecular formula C12H26N4O and a molecular weight of 242.37 g/mol. Its IUPAC name is N-amino-N'-(1-methoxypropan-2-yl)-2,3-dimethylpiperidine-1-carboximidamide.
| Compound Name | N-amino-N'-(1-methoxypropan-2-yl)-2,3-dimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 104884194 |
| Molecular Formula | C12H26N4O |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | N-amino-N'-(1-methoxypropan-2-yl)-2,3-dimethylpiperidine-1-carboximidamide |
| SMILES | COCC(C)/N=C(\NN)N1CCCC(C)C1C |
| InChI | InChI=1S/C12H26N4O/c1-9-6-5-7-16(11(9)3)12(15-13)14-10(2)8-17-4/h9-11H,5-8,13H2,1-4H3,(H,14,15) |
| InChIKey | OBZTVVLABFJXBH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|