C12H27N5O2 — CID 104887113
N-amino-2-[(dimethylamino)methyl]-4-hydroxy-N'-(1-methoxypropan-2-yl)pyrrolidine-1-carboximidamide (PubChem CID 104887113) has the molecular formula C12H27N5O2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N-amino-2-[(dimethylamino)methyl]-4-hydroxy-N'-(1-methoxypropan-2-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-amino-2-[(dimethylamino)methyl]-4-hydroxy-N'-(1-methoxypropan-2-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 104887113 |
| Molecular Formula | C12H27N5O2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | N-amino-2-[(dimethylamino)methyl]-4-hydroxy-N'-(1-methoxypropan-2-yl)pyrrolidine-1-carboximidamide |
| SMILES | COCC(C)/N=C(\NN)N1CC(O)CC1CN(C)C |
| InChI | InChI=1S/C12H27N5O2/c1-9(8-19-4)14-12(15-13)17-7-11(18)5-10(17)6-16(2)3/h9-11,18H,5-8,13H2,1-4H3,(H,14,15) |
| InChIKey | IRIFTOGYGNTZDO-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|