C10H23N5 — CID 104884151
1-amino-2-[(1-methylpyrrolidin-3-yl)methyl]-3-propan-2-ylguanidine (PubChem CID 104884151) has the molecular formula C10H23N5 and a molecular weight of 213.33 g/mol. Its IUPAC name is 1-amino-2-[(1-methylpyrrolidin-3-yl)methyl]-3-propan-2-ylguanidine.
| Compound Name | 1-amino-2-[(1-methylpyrrolidin-3-yl)methyl]-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 104884151 |
| Molecular Formula | C10H23N5 |
| Molecular Weight | 213.33 g/mol |
| Exact Mass | 213.20 |
| IUPAC Name | 1-amino-2-[(1-methylpyrrolidin-3-yl)methyl]-3-propan-2-ylguanidine |
| SMILES | CC(C)N/C(=N\CC1CCN(C)C1)NN |
| InChI | InChI=1S/C10H23N5/c1-8(2)13-10(14-11)12-6-9-4-5-15(3)7-9/h8-9H,4-7,11H2,1-3H3,(H2,12,13,14) |
| InChIKey | RZIUECLUHWIUOE-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.33 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|