C7H16N4 — CID 55134240
2-[(1-methylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 55134240) has the molecular formula C7H16N4 and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-[(1-methylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 2-[(1-methylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 55134240 |
| Molecular Formula | C7H16N4 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 2-[(1-methylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | CN1CCC(CN=C(N)N)C1 |
| InChI | InChI=1S/C7H16N4/c1-11-3-2-6(5-11)4-10-7(8)9/h6H,2-5H2,1H3,(H4,8,9,10) |
| InChIKey | HCKYDZSMXXCBEM-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|