C7H16N4O — CID 62482086
1-hydroxy-2-[(1-methylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 62482086) has the molecular formula C7H16N4O and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-hydroxy-2-[(1-methylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 1-hydroxy-2-[(1-methylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 62482086 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-hydroxy-2-[(1-methylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | CN1CCC(C/N=C(\N)NO)C1 |
| InChI | InChI=1S/C7H16N4O/c1-11-3-2-6(5-11)4-9-7(8)10-12/h6,12H,2-5H2,1H3,(H3,8,9,10) |
| InChIKey | HZACGSJHNOYQGO-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|