C14H30N4 — CID 104884230
N-amino-4-tert-butyl-N'-(2-methylpropyl)piperidine-1-carboximidamide (PubChem CID 104884230) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is N-amino-4-tert-butyl-N'-(2-methylpropyl)piperidine-1-carboximidamide.
| Compound Name | N-amino-4-tert-butyl-N'-(2-methylpropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 104884230 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | N-amino-4-tert-butyl-N'-(2-methylpropyl)piperidine-1-carboximidamide |
| SMILES | CC(C)C/N=C(\NN)N1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H30N4/c1-11(2)10-16-13(17-15)18-8-6-12(7-9-18)14(3,4)5/h11-12H,6-10,15H2,1-5H3,(H,16,17) |
| InChIKey | OFULJRCCUOBLSY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|