C10H22N4S — CID 104885614
N-amino-N'-(2-methylpropyl)-1,4-thiazepane-4-carboximidamide (PubChem CID 104885614) has the molecular formula C10H22N4S and a molecular weight of 230.38 g/mol. Its IUPAC name is N-amino-N'-(2-methylpropyl)-1,4-thiazepane-4-carboximidamide.
| Compound Name | N-amino-N'-(2-methylpropyl)-1,4-thiazepane-4-carboximidamide |
|---|---|
| PubChem CID | 104885614 |
| Molecular Formula | C10H22N4S |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | N-amino-N'-(2-methylpropyl)-1,4-thiazepane-4-carboximidamide |
| SMILES | CC(C)C/N=C(\NN)N1CCCSCC1 |
| InChI | InChI=1S/C10H22N4S/c1-9(2)8-12-10(13-11)14-4-3-6-15-7-5-14/h9H,3-8,11H2,1-2H3,(H,12,13) |
| InChIKey | SPXIHJCEEHTQBR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|