C12H27N5 — CID 104886298
N-amino-3,3,4-trimethyl-N'-(2-methylpropyl)piperazine-1-carboximidamide (PubChem CID 104886298) has the molecular formula C12H27N5 and a molecular weight of 241.38 g/mol. Its IUPAC name is N-amino-3,3,4-trimethyl-N'-(2-methylpropyl)piperazine-1-carboximidamide.
| Compound Name | N-amino-3,3,4-trimethyl-N'-(2-methylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 104886298 |
| Molecular Formula | C12H27N5 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.23 |
| IUPAC Name | N-amino-3,3,4-trimethyl-N'-(2-methylpropyl)piperazine-1-carboximidamide |
| SMILES | CC(C)C/N=C(\NN)N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C12H27N5/c1-10(2)8-14-11(15-13)17-7-6-16(5)12(3,4)9-17/h10H,6-9,13H2,1-5H3,(H,14,15) |
| InChIKey | GNYRCPMNTSIIRC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|