C13H24F3N5 — CID 104885931
N-amino-N'-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide (PubChem CID 104885931) has the molecular formula C13H24F3N5 and a molecular weight of 307.36 g/mol. Its IUPAC name is N-amino-N'-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide.
| Compound Name | N-amino-N'-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 104885931 |
| Molecular Formula | C13H24F3N5 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-amino-N'-cyclohexyl-4-(2,2,2-trifluoroethyl)piperazine-1-carboximidamide |
| SMILES | NN/C(=N\C1CCCCC1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H24F3N5/c14-13(15,16)10-20-6-8-21(9-7-20)12(19-17)18-11-4-2-1-3-5-11/h11H,1-10,17H2,(H,18,19) |
| InChIKey | CJRYIUPUXZDILY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|