C12H21N5S — CID 104886233
3-amino-2-cyclopentyl-1-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine (PubChem CID 104886233) has the molecular formula C12H21N5S and a molecular weight of 267.40 g/mol. Its IUPAC name is 3-amino-2-cyclopentyl-1-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine.
| Compound Name | 3-amino-2-cyclopentyl-1-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 104886233 |
| Molecular Formula | C12H21N5S |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-amino-2-cyclopentyl-1-methyl-1-[(4-methyl-1,3-thiazol-5-yl)methyl]guanidine |
| SMILES | Cc1ncsc1CN(C)/C(=N/C1CCCC1)NN |
| InChI | InChI=1S/C12H21N5S/c1-9-11(18-8-14-9)7-17(2)12(16-13)15-10-5-3-4-6-10/h8,10H,3-7,13H2,1-2H3,(H,15,16) |
| InChIKey | PVOKEKMJQMZBJP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|