C13H22N4S — CID 116513310
3-amino-2-cyclohexyl-1-methyl-1-(thiophen-3-ylmethyl)guanidine (PubChem CID 116513310) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is 3-amino-2-cyclohexyl-1-methyl-1-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 3-amino-2-cyclohexyl-1-methyl-1-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 116513310 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-amino-2-cyclohexyl-1-methyl-1-(thiophen-3-ylmethyl)guanidine |
| SMILES | CN(Cc1ccsc1)/C(=N/C1CCCCC1)NN |
| InChI | InChI=1S/C13H22N4S/c1-17(9-11-7-8-18-10-11)13(16-14)15-12-5-3-2-4-6-12/h7-8,10,12H,2-6,9,14H2,1H3,(H,15,16) |
| InChIKey | LLIUOAULCNDXSD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|