C10H23N5O — CID 104887115
N-amino-2-[(dimethylamino)methyl]-N'-ethyl-4-hydroxypyrrolidine-1-carboximidamide (PubChem CID 104887115) has the molecular formula C10H23N5O and a molecular weight of 229.33 g/mol. Its IUPAC name is N-amino-2-[(dimethylamino)methyl]-N'-ethyl-4-hydroxypyrrolidine-1-carboximidamide.
| Compound Name | N-amino-2-[(dimethylamino)methyl]-N'-ethyl-4-hydroxypyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 104887115 |
| Molecular Formula | C10H23N5O |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.19 |
| IUPAC Name | N-amino-2-[(dimethylamino)methyl]-N'-ethyl-4-hydroxypyrrolidine-1-carboximidamide |
| SMILES | CC/N=C(\NN)N1CC(O)CC1CN(C)C |
| InChI | InChI=1S/C10H23N5O/c1-4-12-10(13-11)15-7-9(16)5-8(15)6-14(2)3/h8-9,16H,4-7,11H2,1-3H3,(H,12,13) |
| InChIKey | FHXWBSSBSLAWPN-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|