About 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine
3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine (PubChem CID 104889630) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine.
Molecular Properties
| Compound Name | 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine |
| PubChem CID | 104889630 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine |
| SMILES | CC(=CC1CCC(C)(C)O1)CC1COCCN1 |
| InChI | InChI=1S/C14H25NO2/c1-11(8-12-10-16-7-6-15-12)9-13-4-5-14(2,3)17-13/h9,12-13,15H,4-8,10H2,1-3H3 |
| InChIKey | GHYMSZSGVXGWKQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine?
The IUPAC name of 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine (CID 104889630) is 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine.
What is the SMILES notation for 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine?
The canonical SMILES for 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine is CC(=CC1CCC(C)(C)O1)CC1COCCN1.
What is the InChIKey of 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine?
The InChIKey is GHYMSZSGVXGWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO2/c1-11(8-12-10-16-7-6-15-12)9-13-4-5-14(2,3)17-13/h9,12-13,15H,4-8,10H2,1-3H3.
What are the key properties of 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine?
3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine has a molecular weight of 239.36 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine is sourced from PubChem (CID 104889630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).