C14H25NO2 — CID 104889630
3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine (PubChem CID 104889630) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine.
| Compound Name | 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine |
|---|---|
| PubChem CID | 104889630 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 3-[3-(5,5-dimethyloxolan-2-yl)-2-methylprop-2-enyl]morpholine |
| SMILES | CC(=CC1CCC(C)(C)O1)CC1COCCN1 |
| InChI | InChI=1S/C14H25NO2/c1-11(8-12-10-16-7-6-15-12)9-13-4-5-14(2,3)17-13/h9,12-13,15H,4-8,10H2,1-3H3 |
| InChIKey | GHYMSZSGVXGWKQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|