C12H14F3NO5 — CID 104890123
(1R)-1-[5-nitro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol (PubChem CID 104890123) has the molecular formula C12H14F3NO5 and a molecular weight of 309.24 g/mol. Its IUPAC name is (1R)-1-[5-nitro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol.
| Compound Name | (1R)-1-[5-nitro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 104890123 |
| Molecular Formula | C12H14F3NO5 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (1R)-1-[5-nitro-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanol |
| SMILES | C[C@@H](O)c1cc([N+](=O)[O-])ccc1OCCOCC(F)(F)F |
| InChI | InChI=1S/C12H14F3NO5/c1-8(17)10-6-9(16(18)19)2-3-11(10)21-5-4-20-7-12(13,14)15/h2-3,6,8,17H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | JFFPZSGNZAMYAL-MRVPVSSYSA-N |
| XLogP | 2.61 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|