C13H13BrN2O5 — CID 104890824
(1R)-1-[5-bromo-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]-3-nitrophenyl]ethanol (PubChem CID 104890824) has the molecular formula C13H13BrN2O5 and a molecular weight of 357.16 g/mol. Its IUPAC name is (1R)-1-[5-bromo-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]-3-nitrophenyl]ethanol.
| Compound Name | (1R)-1-[5-bromo-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]-3-nitrophenyl]ethanol |
|---|---|
| PubChem CID | 104890824 |
| Molecular Formula | C13H13BrN2O5 |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 356.00 |
| IUPAC Name | (1R)-1-[5-bromo-2-[(3-methyl-1,2-oxazol-5-yl)methoxy]-3-nitrophenyl]ethanol |
| SMILES | Cc1cc(COc2c([C@@H](C)O)cc(Br)cc2[N+](=O)[O-])on1 |
| InChI | InChI=1S/C13H13BrN2O5/c1-7-3-10(21-15-7)6-20-13-11(8(2)17)4-9(14)5-12(13)16(18)19/h3-5,8,17H,6H2,1-2H3/t8-/m1/s1 |
| InChIKey | OJGZOCQNRNPPAF-MRVPVSSYSA-N |
| XLogP | 3.29 |
| TPSA | 98.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|