C12H12BrN3O5 — CID 116542154
1-[5-bromo-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]-3-nitrophenyl]ethanol (PubChem CID 116542154) has the molecular formula C12H12BrN3O5 and a molecular weight of 358.15 g/mol. Its IUPAC name is 1-[5-bromo-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]-3-nitrophenyl]ethanol.
| Compound Name | 1-[5-bromo-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]-3-nitrophenyl]ethanol |
|---|---|
| PubChem CID | 116542154 |
| Molecular Formula | C12H12BrN3O5 |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 1-[5-bromo-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methoxy]-3-nitrophenyl]ethanol |
| SMILES | Cc1nonc1COc1c(C(C)O)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12BrN3O5/c1-6-10(15-21-14-6)5-20-12-9(7(2)17)3-8(13)4-11(12)16(18)19/h3-4,7,17H,5H2,1-2H3 |
| InChIKey | WJRKGMLDWUBXSH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|