C14H15F2NS — CID 104893383
2,2-difluoro-2-phenyl-N-[(1S)-1-thiophen-2-ylethyl]ethanamine (PubChem CID 104893383) has the molecular formula C14H15F2NS and a molecular weight of 267.34 g/mol. Its IUPAC name is 2,2-difluoro-2-phenyl-N-[(1S)-1-thiophen-2-ylethyl]ethanamine.
| Compound Name | 2,2-difluoro-2-phenyl-N-[(1S)-1-thiophen-2-ylethyl]ethanamine |
|---|---|
| PubChem CID | 104893383 |
| Molecular Formula | C14H15F2NS |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2,2-difluoro-2-phenyl-N-[(1S)-1-thiophen-2-ylethyl]ethanamine |
| SMILES | C[C@H](NCC(F)(F)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C14H15F2NS/c1-11(13-8-5-9-18-13)17-10-14(15,16)12-6-3-2-4-7-12/h2-9,11,17H,10H2,1H3/t11-/m0/s1 |
| InChIKey | FGJYCQSPIALQNU-NSHDSACASA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |