C15H17N3O3 — CID 104896639
(3S)-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide (PubChem CID 104896639) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (3S)-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide.
| Compound Name | (3S)-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 104896639 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3S)-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| SMILES | CN1C(=O)CC(NC(=O)[C@@H]2Cc3ccccc3CN2)C1=O |
| InChI | InChI=1S/C15H17N3O3/c1-18-13(19)7-12(15(18)21)17-14(20)11-6-9-4-2-3-5-10(9)8-16-11/h2-5,11-12,16H,6-8H2,1H3,(H,17,20)/t11-,12?/m0/s1 |
| InChIKey | VRFLHUXUHQFRNF-PXYINDEMSA-N |
| XLogP | -0.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|