C15H20N4O — CID 104902244
(1R)-2-phenyl-1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 104902244) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is (1R)-2-phenyl-1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | (1R)-2-phenyl-1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 104902244 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (1R)-2-phenyl-1-(3-piperidin-1-yl-1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | N[C@H](Cc1ccccc1)c1nc(N2CCCCC2)no1 |
| InChI | InChI=1S/C15H20N4O/c16-13(11-12-7-3-1-4-8-12)14-17-15(18-20-14)19-9-5-2-6-10-19/h1,3-4,7-8,13H,2,5-6,9-11,16H2/t13-/m1/s1 |
| InChIKey | WNZRZTPAGWVPBY-CYBMUJFWSA-N |
| XLogP | 2.30 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |