C16H25N3OS — CID 104908137
(2R)-2-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]-4-methylsulfanylbutanamide (PubChem CID 104908137) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104908137 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2R)-2-amino-N-[3-(2,3-dihydroindol-1-yl)propyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)NCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C16H25N3OS/c1-21-12-8-14(17)16(20)18-9-4-10-19-11-7-13-5-2-3-6-15(13)19/h2-3,5-6,14H,4,7-12,17H2,1H3,(H,18,20)/t14-/m1/s1 |
| InChIKey | FHYVRGACRUIEGX-CQSZACIVSA-N |
| XLogP | 1.64 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|