C12H18N2O4S2 — CID 104908842
(2R)-2-amino-N-(2-hydroxy-5-methylsulfonylphenyl)-4-methylsulfanylbutanamide (PubChem CID 104908842) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-hydroxy-5-methylsulfonylphenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-(2-hydroxy-5-methylsulfonylphenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104908842 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (2R)-2-amino-N-(2-hydroxy-5-methylsulfonylphenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)Nc1cc(S(C)(=O)=O)ccc1O |
| InChI | InChI=1S/C12H18N2O4S2/c1-19-6-5-9(13)12(16)14-10-7-8(20(2,17)18)3-4-11(10)15/h3-4,7,9,15H,5-6,13H2,1-2H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | AQQFGWTUZCRQTP-SECBINFHSA-N |
| XLogP | 0.81 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|