C11H22N2O3S — CID 104909167
(2R)-2-[3-(aminomethyl)pentanoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 104909167) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is (2R)-2-[3-(aminomethyl)pentanoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[3-(aminomethyl)pentanoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104909167 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2R)-2-[3-(aminomethyl)pentanoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CCC(CN)CC(=O)N[C@H](CCSC)C(=O)O |
| InChI | InChI=1S/C11H22N2O3S/c1-3-8(7-12)6-10(14)13-9(11(15)16)4-5-17-2/h8-9H,3-7,12H2,1-2H3,(H,13,14)(H,15,16)/t8?,9-/m1/s1 |
| InChIKey | MZFAEHBWMSIQCQ-YGPZHTELSA-N |
| XLogP | 0.68 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |