C12H20N2O3S — CID 104910508
(2R)-4-methylsulfanyl-2-[[propyl(prop-2-ynyl)carbamoyl]amino]butanoic acid (PubChem CID 104910508) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[[propyl(prop-2-ynyl)carbamoyl]amino]butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-[[propyl(prop-2-ynyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 104910508 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[[propyl(prop-2-ynyl)carbamoyl]amino]butanoic acid |
| SMILES | C#CCN(CCC)C(=O)N[C@H](CCSC)C(=O)O |
| InChI | InChI=1S/C12H20N2O3S/c1-4-7-14(8-5-2)12(17)13-10(11(15)16)6-9-18-3/h1,10H,5-9H2,2-3H3,(H,13,17)(H,15,16)/t10-/m1/s1 |
| InChIKey | BVMXMHQLVRHFRB-SNVBAGLBSA-N |
| XLogP | 1.25 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|