C11H11Cl2N3O3 — CID 104917416
5-(2,6-dichloro-4-nitroanilino)piperidin-2-one (PubChem CID 104917416) has the molecular formula C11H11Cl2N3O3 and a molecular weight of 304.13 g/mol. Its IUPAC name is 5-(2,6-dichloro-4-nitroanilino)piperidin-2-one.
| Compound Name | 5-(2,6-dichloro-4-nitroanilino)piperidin-2-one |
|---|---|
| PubChem CID | 104917416 |
| Molecular Formula | C11H11Cl2N3O3 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 5-(2,6-dichloro-4-nitroanilino)piperidin-2-one |
| SMILES | O=C1CCC(Nc2c(Cl)cc([N+](=O)[O-])cc2Cl)CN1 |
| InChI | InChI=1S/C11H11Cl2N3O3/c12-8-3-7(16(18)19)4-9(13)11(8)15-6-1-2-10(17)14-5-6/h3-4,6,15H,1-2,5H2,(H,14,17) |
| InChIKey | BVUJYZJPEJRGEE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|