C11H9F5N2O — CID 63662841
5-(2,3,4,5,6-pentafluoroanilino)piperidin-2-one (PubChem CID 63662841) has the molecular formula C11H9F5N2O and a molecular weight of 280.20 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentafluoroanilino)piperidin-2-one.
| Compound Name | 5-(2,3,4,5,6-pentafluoroanilino)piperidin-2-one |
|---|---|
| PubChem CID | 63662841 |
| Molecular Formula | C11H9F5N2O |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 5-(2,3,4,5,6-pentafluoroanilino)piperidin-2-one |
| SMILES | O=C1CCC(Nc2c(F)c(F)c(F)c(F)c2F)CN1 |
| InChI | InChI=1S/C11H9F5N2O/c12-6-7(13)9(15)11(10(16)8(6)14)18-4-1-2-5(19)17-3-4/h4,18H,1-3H2,(H,17,19) |
| InChIKey | IBLZDSHHUAYVTI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|