C12H13Br2NO2S — CID 104919707
(2,5-dibromothiophen-3-yl)-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 104919707) has the molecular formula C12H13Br2NO2S and a molecular weight of 395.12 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (2,5-dibromothiophen-3-yl)-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 104919707 |
| Molecular Formula | C12H13Br2NO2S |
| Molecular Weight | 395.12 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | COCC1=CCN(C(=O)c2cc(Br)sc2Br)CC1 |
| InChI | InChI=1S/C12H13Br2NO2S/c1-17-7-8-2-4-15(5-3-8)12(16)9-6-10(13)18-11(9)14/h2,6H,3-5,7H2,1H3 |
| InChIKey | DUZRFPXYNBWCHI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.12 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|