C14H14BrF2NO2 — CID 114390156
(4-bromo-2,6-difluorophenyl)-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone (PubChem CID 114390156) has the molecular formula C14H14BrF2NO2 and a molecular weight of 346.17 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone.
| Compound Name | (4-bromo-2,6-difluorophenyl)-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 114390156 |
| Molecular Formula | C14H14BrF2NO2 |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methanone |
| SMILES | COCC1=CCN(C(=O)c2c(F)cc(Br)cc2F)CC1 |
| InChI | InChI=1S/C14H14BrF2NO2/c1-20-8-9-2-4-18(5-3-9)14(19)13-11(16)6-10(15)7-12(13)17/h2,6-7H,3-5,8H2,1H3 |
| InChIKey | QOGLKGIJGCVLSC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|