C14H19N3O4 — CID 104920904
4-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]-3-methylbut-2-enoic acid (PubChem CID 104920904) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]-3-methylbut-2-enoic acid.
| Compound Name | 4-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]-3-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 104920904 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]-3-methylbut-2-enoic acid |
| SMILES | COC1CCN(c2cnn(CC(C)=CC(=O)O)c(=O)c2)C1 |
| InChI | InChI=1S/C14H19N3O4/c1-10(5-14(19)20)8-17-13(18)6-11(7-15-17)16-4-3-12(9-16)21-2/h5-7,12H,3-4,8-9H2,1-2H3,(H,19,20) |
| InChIKey | CRHICLIPIAFZGH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|