C12H19N3O3 — CID 104920983
2-[(2S)-2-hydroxypropyl]-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one (PubChem CID 104920983) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[(2S)-2-hydroxypropyl]-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one.
| Compound Name | 2-[(2S)-2-hydroxypropyl]-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 104920983 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-[(2S)-2-hydroxypropyl]-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one |
| SMILES | COC1CCN(c2cnn(C[C@H](C)O)c(=O)c2)C1 |
| InChI | InChI=1S/C12H19N3O3/c1-9(16)7-15-12(17)5-10(6-13-15)14-4-3-11(8-14)18-2/h5-6,9,11,16H,3-4,7-8H2,1-2H3/t9-,11?/m0/s1 |
| InChIKey | XTVFKHJKSNSAQC-FTNKSUMCSA-N |
| XLogP | -0.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |