C12H17F2LiO4 — CID 10492242
lithium 1,1-difluoro-2-(2-methoxyethoxymethoxy)-3-prop-2-ynoxypent-1-ene (PubChem CID 10492242) has the molecular formula C12H17F2LiO4 and a molecular weight of 270.20 g/mol. Its IUPAC name is lithium 1,1-difluoro-2-(2-methoxyethoxymethoxy)-3-prop-2-ynoxypent-1-ene.
| Compound Name | lithium 1,1-difluoro-2-(2-methoxyethoxymethoxy)-3-prop-2-ynoxypent-1-ene |
|---|---|
| PubChem CID | 10492242 |
| Molecular Formula | C12H17F2LiO4 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | lithium 1,1-difluoro-2-(2-methoxyethoxymethoxy)-3-prop-2-ynoxypent-1-ene |
| SMILES | [C-]#CCOC(CC)C(OCOCCOC)=C(F)F.[Li+] |
| InChI | InChI=1S/C12H17F2O4.Li/c1-4-6-17-10(5-2)11(12(13)14)18-9-16-8-7-15-3;/h10H,5-9H2,2-3H3;/q-1;+1 |
| InChIKey | IUVZDPRXRDPZMV-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|