C15H27BrF4O5Si — CID 10624228
[2-bromo-1-[1,1-difluoro-2-(2-methoxyethoxymethoxy)-4-methylpent-1-en-3-yl]oxy-2,2-difluoroethoxy]-trimethylsilane (PubChem CID 10624228) has the molecular formula C15H27BrF4O5Si and a molecular weight of 471.36 g/mol. Its IUPAC name is [2-bromo-1-[1,1-difluoro-2-(2-methoxyethoxymethoxy)-4-methylpent-1-en-3-yl]oxy-2,2-difluoroethoxy]-trimethylsilane.
| Compound Name | [2-bromo-1-[1,1-difluoro-2-(2-methoxyethoxymethoxy)-4-methylpent-1-en-3-yl]oxy-2,2-difluoroethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 10624228 |
| Molecular Formula | C15H27BrF4O5Si |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | [2-bromo-1-[1,1-difluoro-2-(2-methoxyethoxymethoxy)-4-methylpent-1-en-3-yl]oxy-2,2-difluoroethoxy]-trimethylsilane |
| SMILES | COCCOCOC(=C(F)F)C(OC(O[Si](C)(C)C)C(F)(F)Br)C(C)C |
| InChI | InChI=1S/C15H27BrF4O5Si/c1-10(2)11(12(13(17)18)23-9-22-8-7-21-3)24-14(15(16,19)20)25-26(4,5)6/h10-11,14H,7-9H2,1-6H3 |
| InChIKey | OUKUVPKOPJQPKS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|