C11H18F2O4 — CID 10562743
4,4-difluoro-5-(2-methoxyethoxymethoxy)-2-methylhexa-1,5-dien-3-ol (PubChem CID 10562743) has the molecular formula C11H18F2O4 and a molecular weight of 252.26 g/mol. Its IUPAC name is 4,4-difluoro-5-(2-methoxyethoxymethoxy)-2-methylhexa-1,5-dien-3-ol.
| Compound Name | 4,4-difluoro-5-(2-methoxyethoxymethoxy)-2-methylhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 10562743 |
| Molecular Formula | C11H18F2O4 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 4,4-difluoro-5-(2-methoxyethoxymethoxy)-2-methylhexa-1,5-dien-3-ol |
| SMILES | C=C(C)C(O)C(F)(F)C(=C)OCOCCOC |
| InChI | InChI=1S/C11H18F2O4/c1-8(2)10(14)11(12,13)9(3)17-7-16-6-5-15-4/h10,14H,1,3,5-7H2,2,4H3 |
| InChIKey | GHYDIBOVBRSJIF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|