C13H22F2O4 — CID 10540693
1,1-difluoro-2-(2-methoxyethoxymethoxy)-3-(2-methylprop-2-enoxy)pent-1-ene (PubChem CID 10540693) has the molecular formula C13H22F2O4 and a molecular weight of 280.31 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-methoxyethoxymethoxy)-3-(2-methylprop-2-enoxy)pent-1-ene.
| Compound Name | 1,1-difluoro-2-(2-methoxyethoxymethoxy)-3-(2-methylprop-2-enoxy)pent-1-ene |
|---|---|
| PubChem CID | 10540693 |
| Molecular Formula | C13H22F2O4 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1,1-difluoro-2-(2-methoxyethoxymethoxy)-3-(2-methylprop-2-enoxy)pent-1-ene |
| SMILES | C=C(C)COC(CC)C(OCOCCOC)=C(F)F |
| InChI | InChI=1S/C13H22F2O4/c1-5-11(18-8-10(2)3)12(13(14)15)19-9-17-7-6-16-4/h11H,2,5-9H2,1,3-4H3 |
| InChIKey | HHKCJOUZEVVQOM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|