C13H22F2O4 — CID 10779109
(5Z)-4,4-difluoro-5-(2-methoxyethoxymethoxy)-2-methylocta-1,5-dien-3-ol (PubChem CID 10779109) has the molecular formula C13H22F2O4 and a molecular weight of 280.31 g/mol. Its IUPAC name is (5Z)-4,4-difluoro-5-(2-methoxyethoxymethoxy)-2-methylocta-1,5-dien-3-ol.
| Compound Name | (5Z)-4,4-difluoro-5-(2-methoxyethoxymethoxy)-2-methylocta-1,5-dien-3-ol |
|---|---|
| PubChem CID | 10779109 |
| Molecular Formula | C13H22F2O4 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (5Z)-4,4-difluoro-5-(2-methoxyethoxymethoxy)-2-methylocta-1,5-dien-3-ol |
| SMILES | C=C(C)C(O)C(F)(F)/C(=C/CC)OCOCCOC |
| InChI | InChI=1S/C13H22F2O4/c1-5-6-11(19-9-18-8-7-17-4)13(14,15)12(16)10(2)3/h6,12,16H,2,5,7-9H2,1,3-4H3/b11-6- |
| InChIKey | KLSWXTBISIQRMK-WDZFZDKYSA-N |
| XLogP | 2.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|