C13H16F2O4 — CID 102301219
1-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]-4-methoxybenzene (PubChem CID 102301219) has the molecular formula C13H16F2O4 and a molecular weight of 274.26 g/mol. Its IUPAC name is 1-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]-4-methoxybenzene.
| Compound Name | 1-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 102301219 |
| Molecular Formula | C13H16F2O4 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-[2,2-difluoro-1-(2-methoxyethoxymethoxy)ethenyl]-4-methoxybenzene |
| SMILES | COCCOCOC(=C(F)F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H16F2O4/c1-16-7-8-18-9-19-12(13(14)15)10-3-5-11(17-2)6-4-10/h3-6H,7-9H2,1-2H3 |
| InChIKey | KCKRPMVGQBBIKQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|