C11H12F2O3 — CID 102291968
1-[2,2-difluoro-1-(methoxymethoxy)ethenyl]-4-methoxybenzene (PubChem CID 102291968) has the molecular formula C11H12F2O3 and a molecular weight of 230.21 g/mol. Its IUPAC name is 1-[2,2-difluoro-1-(methoxymethoxy)ethenyl]-4-methoxybenzene.
| Compound Name | 1-[2,2-difluoro-1-(methoxymethoxy)ethenyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 102291968 |
| Molecular Formula | C11H12F2O3 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-[2,2-difluoro-1-(methoxymethoxy)ethenyl]-4-methoxybenzene |
| SMILES | COCOC(=C(F)F)c1ccc(OC)cc1 |
| InChI | InChI=1S/C11H12F2O3/c1-14-7-16-10(11(12)13)8-3-5-9(15-2)6-4-8/h3-6H,7H2,1-2H3 |
| InChIKey | FGZSAVLDJQCFMX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|